C18H16F2N4O2S — CID 55729502
2-[2-[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]phenyl]acetamide (PubChem CID 55729502) has the molecular formula C18H16F2N4O2S and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-[2-[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]phenyl]acetamide.
| Compound Name | 2-[2-[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 55729502 |
| Molecular Formula | C18H16F2N4O2S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-[2-[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]phenyl]acetamide |
| SMILES | NC(=O)Cc1ccccc1NC(=O)Cn1c(SC(F)F)nc2ccccc21 |
| InChI | InChI=1S/C18H16F2N4O2S/c19-17(20)27-18-23-13-7-3-4-8-14(13)24(18)10-16(26)22-12-6-2-1-5-11(12)9-15(21)25/h1-8,17H,9-10H2,(H2,21,25)(H,22,26) |
| InChIKey | IAJIUXIMAJVVDT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |