C20H20F2N4OS — CID 30764002
2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 30764002) has the molecular formula C20H20F2N4OS and a molecular weight of 402.47 g/mol. Its IUPAC name is 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 30764002 |
| Molecular Formula | C20H20F2N4OS |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(Cn1c(SC(F)F)nc2ccccc21)Nc1ccccc1N1CCCC1 |
| InChI | InChI=1S/C20H20F2N4OS/c21-19(22)28-20-24-15-8-2-4-10-17(15)26(20)13-18(27)23-14-7-1-3-9-16(14)25-11-5-6-12-25/h1-4,7-10,19H,5-6,11-13H2,(H,23,27) |
| InChIKey | GPUIZRQMVCKJHW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |