C19H17F2N3O3S — CID 55406136
methyl 4-[[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]methyl]benzoate (PubChem CID 55406136) has the molecular formula C19H17F2N3O3S and a molecular weight of 405.43 g/mol. Its IUPAC name is methyl 4-[[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 55406136 |
| Molecular Formula | C19H17F2N3O3S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | methyl 4-[[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)Cn2c(SC(F)F)nc3ccccc32)cc1 |
| InChI | InChI=1S/C19H17F2N3O3S/c1-27-17(26)13-8-6-12(7-9-13)10-22-16(25)11-24-15-5-3-2-4-14(15)23-19(24)28-18(20)21/h2-9,18H,10-11H2,1H3,(H,22,25) |
| InChIKey | NNDNCXRORMXJLB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |