C16H15F2N3OS2 — CID 31365115
2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 31365115) has the molecular formula C16H15F2N3OS2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 31365115 |
| Molecular Formula | C16H15F2N3OS2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(Cn1c(SC(F)F)nc2ccccc21)NCCc1cccs1 |
| InChI | InChI=1S/C16H15F2N3OS2/c17-15(18)24-16-20-12-5-1-2-6-13(12)21(16)10-14(22)19-8-7-11-4-3-9-23-11/h1-6,9,15H,7-8,10H2,(H,19,22) |
| InChIKey | CUYNYFFPPYBTSR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |