C20H26F2N4OS — CID 56569606
2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide (PubChem CID 56569606) has the molecular formula C20H26F2N4OS and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide.
| Compound Name | 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 56569606 |
| Molecular Formula | C20H26F2N4OS |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)Cn2c(SC(F)F)nc3ccccc32)CC1 |
| InChI | InChI=1S/C20H26F2N4OS/c1-14(2)7-10-25-11-8-15(9-12-25)23-18(27)13-26-17-6-4-3-5-16(17)24-20(26)28-19(21)22/h3-7,15,19H,8-13H2,1-2H3,(H,23,27) |
| InChIKey | DHAVBLCRPLHZON-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|