C12H11FN2O3 — CID 75433797
N-(5-fluoro-2-hydroxyphenyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 75433797) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is N-(5-fluoro-2-hydroxyphenyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | N-(5-fluoro-2-hydroxyphenyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 75433797 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-(5-fluoro-2-hydroxyphenyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(CC(=O)Nc2cc(F)ccc2O)no1 |
| InChI | InChI=1S/C12H11FN2O3/c1-7-4-9(15-18-7)6-12(17)14-10-5-8(13)2-3-11(10)16/h2-5,16H,6H2,1H3,(H,14,17) |
| InChIKey | DCGRUDOZXQLUGG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|