C14H17FN4O2 — CID 43612145
N-(2-amino-5-fluorophenyl)-2-[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]acetamide (PubChem CID 43612145) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-2-[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]acetamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-2-[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 43612145 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-2-[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]acetamide |
| SMILES | Cc1cc(CN(C)CC(=O)Nc2cc(F)ccc2N)no1 |
| InChI | InChI=1S/C14H17FN4O2/c1-9-5-11(18-21-9)7-19(2)8-14(20)17-13-6-10(15)3-4-12(13)16/h3-6H,7-8,16H2,1-2H3,(H,17,20) |
| InChIKey | QSRDZRZGRYQMKG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|