C14H15ClFN3OS — CID 61438327
N-(2-amino-5-fluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-methylamino]acetamide (PubChem CID 61438327) has the molecular formula C14H15ClFN3OS and a molecular weight of 327.81 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-methylamino]acetamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 61438327 |
| Molecular Formula | C14H15ClFN3OS |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-methylamino]acetamide |
| SMILES | CN(CC(=O)Nc1cc(F)ccc1N)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H15ClFN3OS/c1-19(7-10-3-5-13(15)21-10)8-14(20)18-12-6-9(16)2-4-11(12)17/h2-6H,7-8,17H2,1H3,(H,18,20) |
| InChIKey | XRUSUMXSFINYRC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|