C15H15Cl2FN2OS — CID 24589255
N-(4-chloro-2-fluorophenyl)-3-[(5-chlorothiophen-2-yl)methyl-methylamino]propanamide (PubChem CID 24589255) has the molecular formula C15H15Cl2FN2OS and a molecular weight of 361.27 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-3-[(5-chlorothiophen-2-yl)methyl-methylamino]propanamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-3-[(5-chlorothiophen-2-yl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 24589255 |
| Molecular Formula | C15H15Cl2FN2OS |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-3-[(5-chlorothiophen-2-yl)methyl-methylamino]propanamide |
| SMILES | CN(CCC(=O)Nc1ccc(Cl)cc1F)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H15Cl2FN2OS/c1-20(9-11-3-5-14(17)22-11)7-6-15(21)19-13-4-2-10(16)8-12(13)18/h2-5,8H,6-7,9H2,1H3,(H,19,21) |
| InChIKey | SBDHXNJBBNIIPF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |