C15H10Br2FNO4 — CID 75433817
[2-(3-fluoroanilino)-2-oxoethyl] 3,5-dibromo-4-hydroxybenzoate (PubChem CID 75433817) has the molecular formula C15H10Br2FNO4 and a molecular weight of 447.05 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 3,5-dibromo-4-hydroxybenzoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 3,5-dibromo-4-hydroxybenzoate |
|---|---|
| PubChem CID | 75433817 |
| Molecular Formula | C15H10Br2FNO4 |
| Molecular Weight | 447.05 g/mol |
| Exact Mass | 444.90 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 3,5-dibromo-4-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(Br)c(O)c(Br)c1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H10Br2FNO4/c16-11-4-8(5-12(17)14(11)21)15(22)23-7-13(20)19-10-3-1-2-9(18)6-10/h1-6,21H,7H2,(H,19,20) |
| InChIKey | HHNOWBOGDLNFDE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.05 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |