C22H24N2O5S — CID 75434277
N-[1-(2-methylsulfonylethyl)-2-oxo-3-pyridinyl]-4-naphthalen-1-yloxybutanamide (PubChem CID 75434277) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[1-(2-methylsulfonylethyl)-2-oxo-3-pyridinyl]-4-naphthalen-1-yloxybutanamide.
| Compound Name | N-[1-(2-methylsulfonylethyl)-2-oxo-3-pyridinyl]-4-naphthalen-1-yloxybutanamide |
|---|---|
| PubChem CID | 75434277 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-[1-(2-methylsulfonylethyl)-2-oxo-3-pyridinyl]-4-naphthalen-1-yloxybutanamide |
| SMILES | CS(=O)(=O)CCn1cccc(NC(=O)CCCOc2cccc3ccccc23)c1=O |
| InChI | InChI=1S/C22H24N2O5S/c1-30(27,28)16-14-24-13-5-10-19(22(24)26)23-21(25)12-6-15-29-20-11-4-8-17-7-2-3-9-18(17)20/h2-5,7-11,13H,6,12,14-16H2,1H3,(H,23,25) |
| InChIKey | CUSQRQVXOHLLEN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|