C24H25N3O4 — CID 56573333
N-(3-amino-3-oxopropyl)-2-(4-naphthalen-1-yloxybutanoylamino)benzamide (PubChem CID 56573333) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-2-(4-naphthalen-1-yloxybutanoylamino)benzamide.
| Compound Name | N-(3-amino-3-oxopropyl)-2-(4-naphthalen-1-yloxybutanoylamino)benzamide |
|---|---|
| PubChem CID | 56573333 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-2-(4-naphthalen-1-yloxybutanoylamino)benzamide |
| SMILES | NC(=O)CCNC(=O)c1ccccc1NC(=O)CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C24H25N3O4/c25-22(28)14-15-26-24(30)19-10-3-4-11-20(19)27-23(29)13-6-16-31-21-12-5-8-17-7-1-2-9-18(17)21/h1-5,7-12H,6,13-16H2,(H2,25,28)(H,26,30)(H,27,29) |
| InChIKey | UZFVORXXXATDFY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|