About 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole
2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole (PubChem CID 75435540) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole |
| PubChem CID | 75435540 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole |
| SMILES | CC1(C2CCN(c3nc4ccccc4[nH]3)CC2)OCCO1 |
| InChI | InChI=1S/C16H21N3O2/c1-16(20-10-11-21-16)12-6-8-19(9-7-12)15-17-13-4-2-3-5-14(13)18-15/h2-5,12H,6-11H2,1H3,(H,17,18) |
| InChIKey | RHOVRWDPGLSDGE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole?
The IUPAC name of 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole (CID 75435540) is 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole.
What is the SMILES notation for 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole?
The canonical SMILES for 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole is CC1(C2CCN(c3nc4ccccc4[nH]3)CC2)OCCO1.
What is the InChIKey of 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole?
The InChIKey is RHOVRWDPGLSDGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-16(20-10-11-21-16)12-6-8-19(9-7-12)15-17-13-4-2-3-5-14(13)18-15/h2-5,12H,6-11H2,1H3,(H,17,18).
What are the key properties of 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole?
2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole has a molecular weight of 287.36 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-1H-benzimidazole is sourced from PubChem (CID 75435540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).