C16H25N3O5 — CID 75437857
tert-butyl N-[1-[(2-methoxyphenyl)carbamoylamino]oxypropan-2-yl]carbamate (PubChem CID 75437857) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is tert-butyl N-[1-[(2-methoxyphenyl)carbamoylamino]oxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2-methoxyphenyl)carbamoylamino]oxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 75437857 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | tert-butyl N-[1-[(2-methoxyphenyl)carbamoylamino]oxypropan-2-yl]carbamate |
| SMILES | COc1ccccc1NC(=O)NOCC(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25N3O5/c1-11(17-15(21)24-16(2,3)4)10-23-19-14(20)18-12-8-6-7-9-13(12)22-5/h6-9,11H,10H2,1-5H3,(H,17,21)(H2,18,19,20) |
| InChIKey | ZTDNWHWWOLRCNM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|