C18H25N3O2 — CID 75439131
1-[(3,5-dimethoxyphenyl)methyl]-4-(2-methylpyrazol-3-yl)piperidine (PubChem CID 75439131) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)methyl]-4-(2-methylpyrazol-3-yl)piperidine.
| Compound Name | 1-[(3,5-dimethoxyphenyl)methyl]-4-(2-methylpyrazol-3-yl)piperidine |
|---|---|
| PubChem CID | 75439131 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)methyl]-4-(2-methylpyrazol-3-yl)piperidine |
| SMILES | COc1cc(CN2CCC(c3ccnn3C)CC2)cc(OC)c1 |
| InChI | InChI=1S/C18H25N3O2/c1-20-18(4-7-19-20)15-5-8-21(9-6-15)13-14-10-16(22-2)12-17(11-14)23-3/h4,7,10-12,15H,5-6,8-9,13H2,1-3H3 |
| InChIKey | NBCQSVBCHZLXBR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |