C15H16ClN5O2S — CID 75440232
6-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 75440232) has the molecular formula C15H16ClN5O2S and a molecular weight of 365.85 g/mol. Its IUPAC name is 6-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 6-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 75440232 |
| Molecular Formula | C15H16ClN5O2S |
| Molecular Weight | 365.85 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 6-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | O=C(c1n[nH]c(=S)[nH]c1=O)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H16ClN5O2S/c16-11-3-1-10(2-4-11)9-20-5-7-21(8-6-20)14(23)12-13(22)17-15(24)19-18-12/h1-4H,5-9H2,(H2,17,19,22,24) |
| InChIKey | HBRMSFPJHWIHMU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.85 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|