C14H16N2O3S2 — CID 75441825
3-[[(4,5-dimethylthiophen-2-yl)sulfonylamino]methyl]benzamide (PubChem CID 75441825) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 3-[[(4,5-dimethylthiophen-2-yl)sulfonylamino]methyl]benzamide.
| Compound Name | 3-[[(4,5-dimethylthiophen-2-yl)sulfonylamino]methyl]benzamide |
|---|---|
| PubChem CID | 75441825 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 3-[[(4,5-dimethylthiophen-2-yl)sulfonylamino]methyl]benzamide |
| SMILES | Cc1cc(S(=O)(=O)NCc2cccc(C(N)=O)c2)sc1C |
| InChI | InChI=1S/C14H16N2O3S2/c1-9-6-13(20-10(9)2)21(18,19)16-8-11-4-3-5-12(7-11)14(15)17/h3-7,16H,8H2,1-2H3,(H2,15,17) |
| InChIKey | BLBKSFDWRMZXQJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |