C17H26N4OS — CID 75442069
N-[2-(1-pyridin-4-ylpiperidin-4-yl)ethyl]thiomorpholine-4-carboxamide (PubChem CID 75442069) has the molecular formula C17H26N4OS and a molecular weight of 334.49 g/mol. Its IUPAC name is N-[2-(1-pyridin-4-ylpiperidin-4-yl)ethyl]thiomorpholine-4-carboxamide.
| Compound Name | N-[2-(1-pyridin-4-ylpiperidin-4-yl)ethyl]thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 75442069 |
| Molecular Formula | C17H26N4OS |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-[2-(1-pyridin-4-ylpiperidin-4-yl)ethyl]thiomorpholine-4-carboxamide |
| SMILES | O=C(NCCC1CCN(c2ccncc2)CC1)N1CCSCC1 |
| InChI | InChI=1S/C17H26N4OS/c22-17(21-11-13-23-14-12-21)19-8-1-15-4-9-20(10-5-15)16-2-6-18-7-3-16/h2-3,6-7,15H,1,4-5,8-14H2,(H,19,22) |
| InChIKey | FOQCMFPDELDPKA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |