C17H28N2O2S — CID 75443056
2-(3-methylphenyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]propan-2-amine (PubChem CID 75443056) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]propan-2-amine.
| Compound Name | 2-(3-methylphenyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 75443056 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2-(3-methylphenyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]propan-2-amine |
| SMILES | Cc1cccc(C(C)(C)NCC2CCCN(S(C)(=O)=O)C2)c1 |
| InChI | InChI=1S/C17H28N2O2S/c1-14-7-5-9-16(11-14)17(2,3)18-12-15-8-6-10-19(13-15)22(4,20)21/h5,7,9,11,15,18H,6,8,10,12-13H2,1-4H3 |
| InChIKey | KMDPSKNWXBNILT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |