C14H17N5O3 — CID 75443487
N-(3-methoxypropyl)-N'-(5-pyridin-2-yl-1H-pyrazol-4-yl)oxamide (PubChem CID 75443487) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N'-(5-pyridin-2-yl-1H-pyrazol-4-yl)oxamide.
| Compound Name | N-(3-methoxypropyl)-N'-(5-pyridin-2-yl-1H-pyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 75443487 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-(3-methoxypropyl)-N'-(5-pyridin-2-yl-1H-pyrazol-4-yl)oxamide |
| SMILES | COCCCNC(=O)C(=O)Nc1cn[nH]c1-c1ccccn1 |
| InChI | InChI=1S/C14H17N5O3/c1-22-8-4-7-16-13(20)14(21)18-11-9-17-19-12(11)10-5-2-3-6-15-10/h2-3,5-6,9H,4,7-8H2,1H3,(H,16,20)(H,17,19)(H,18,21) |
| InChIKey | ITPFBKYGMHATFS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|