C14H13IN2O4S — CID 75449151
methyl 2-iodo-5-[(2-methyl-4-pyridinyl)sulfamoyl]benzoate (PubChem CID 75449151) has the molecular formula C14H13IN2O4S and a molecular weight of 432.24 g/mol. Its IUPAC name is methyl 2-iodo-5-[(2-methyl-4-pyridinyl)sulfamoyl]benzoate.
| Compound Name | methyl 2-iodo-5-[(2-methyl-4-pyridinyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 75449151 |
| Molecular Formula | C14H13IN2O4S |
| Molecular Weight | 432.24 g/mol |
| Exact Mass | 431.96 |
| IUPAC Name | methyl 2-iodo-5-[(2-methyl-4-pyridinyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)Nc2ccnc(C)c2)ccc1I |
| InChI | InChI=1S/C14H13IN2O4S/c1-9-7-10(5-6-16-9)17-22(19,20)11-3-4-13(15)12(8-11)14(18)21-2/h3-8H,1-2H3,(H,16,17) |
| InChIKey | LGBJXDOMQCFCOZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|