C25H27N5O3 — CID 75450631
7-[[1-phenyl-3-(4-propan-2-yloxyphenyl)pyrazol-4-yl]methyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 75450631) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 7-[[1-phenyl-3-(4-propan-2-yloxyphenyl)pyrazol-4-yl]methyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 7-[[1-phenyl-3-(4-propan-2-yloxyphenyl)pyrazol-4-yl]methyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 75450631 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 7-[[1-phenyl-3-(4-propan-2-yloxyphenyl)pyrazol-4-yl]methyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | CC(C)Oc1ccc(-c2nn(-c3ccccc3)cc2CN2CCN3C(=O)NC(=O)C3C2)cc1 |
| InChI | InChI=1S/C25H27N5O3/c1-17(2)33-21-10-8-18(9-11-21)23-19(15-30(27-23)20-6-4-3-5-7-20)14-28-12-13-29-22(16-28)24(31)26-25(29)32/h3-11,15,17,22H,12-14,16H2,1-2H3,(H,26,31,32) |
| InChIKey | TZVYXLHXCNFYOG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|