C19H28N4O2 — CID 75450738
(1,4,4-trimethylcyclohexyl) 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate (PubChem CID 75450738) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (1,4,4-trimethylcyclohexyl) 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate.
| Compound Name | (1,4,4-trimethylcyclohexyl) 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
|---|---|
| PubChem CID | 75450738 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (1,4,4-trimethylcyclohexyl) 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
| SMILES | Cc1nc2ncnn2c(C)c1CCC(=O)OC1(C)CCC(C)(C)CC1 |
| InChI | InChI=1S/C19H28N4O2/c1-13-15(14(2)23-17(22-13)20-12-21-23)6-7-16(24)25-19(5)10-8-18(3,4)9-11-19/h12H,6-11H2,1-5H3 |
| InChIKey | YTQCQSZVAOIATL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |