About 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate
2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate (PubChem CID 75450743) has the molecular formula C14H21NO4
and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate.
Molecular Properties
| Compound Name | 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate |
| PubChem CID | 75450743 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate |
| SMILES | CCCCOCCOC(=O)c1cc(CC)[nH]c(=O)c1 |
| InChI | InChI=1S/C14H21NO4/c1-3-5-6-18-7-8-19-14(17)11-9-12(4-2)15-13(16)10-11/h9-10H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | SJXFQQPSSWKDIK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate?
The IUPAC name of 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate (CID 75450743) is 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate.
What is the SMILES notation for 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate?
The canonical SMILES for 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate is CCCCOCCOC(=O)c1cc(CC)[nH]c(=O)c1.
What is the InChIKey of 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate?
The InChIKey is SJXFQQPSSWKDIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-3-5-6-18-7-8-19-14(17)11-9-12(4-2)15-13(16)10-11/h9-10H,3-8H2,1-2H3,(H,15,16).
What are the key properties of 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate?
2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate has a molecular weight of 267.32 g/mol, XLogP of 1.91, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate is sourced from PubChem (CID 75450743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).