C17H18BrFN4O2 — CID 75452923
2-bromo-N-[3-[[6-(dimethylamino)-2-pyridinyl]amino]-3-oxopropyl]-5-fluorobenzamide (PubChem CID 75452923) has the molecular formula C17H18BrFN4O2 and a molecular weight of 409.26 g/mol. Its IUPAC name is 2-bromo-N-[3-[[6-(dimethylamino)-2-pyridinyl]amino]-3-oxopropyl]-5-fluorobenzamide.
| Compound Name | 2-bromo-N-[3-[[6-(dimethylamino)-2-pyridinyl]amino]-3-oxopropyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 75452923 |
| Molecular Formula | C17H18BrFN4O2 |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-bromo-N-[3-[[6-(dimethylamino)-2-pyridinyl]amino]-3-oxopropyl]-5-fluorobenzamide |
| SMILES | CN(C)c1cccc(NC(=O)CCNC(=O)c2cc(F)ccc2Br)n1 |
| InChI | InChI=1S/C17H18BrFN4O2/c1-23(2)15-5-3-4-14(21-15)22-16(24)8-9-20-17(25)12-10-11(19)6-7-13(12)18/h3-7,10H,8-9H2,1-2H3,(H,20,25)(H,21,22,24) |
| InChIKey | BWAHMPAQQQRSTL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |