C19H24N6O2 — CID 75453963
1-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-4-(3-nitrophenyl)piperazine (PubChem CID 75453963) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-4-(3-nitrophenyl)piperazine.
| Compound Name | 1-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-4-(3-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 75453963 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-4-(3-nitrophenyl)piperazine |
| SMILES | O=[N+]([O-])c1cccc(N2CCN(Cc3nnc(C4CC4)n3C3CC3)CC2)c1 |
| InChI | InChI=1S/C19H24N6O2/c26-25(27)17-3-1-2-16(12-17)23-10-8-22(9-11-23)13-18-20-21-19(14-4-5-14)24(18)15-6-7-15/h1-3,12,14-15H,4-11,13H2 |
| InChIKey | IRRVKOODMUJYEF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|