C12H12N2O5S2 — CID 75454434
4-methyl-3-[2-(4-nitrophenyl)sulfonylethyl]-1,3-thiazol-2-one (PubChem CID 75454434) has the molecular formula C12H12N2O5S2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-methyl-3-[2-(4-nitrophenyl)sulfonylethyl]-1,3-thiazol-2-one.
| Compound Name | 4-methyl-3-[2-(4-nitrophenyl)sulfonylethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 75454434 |
| Molecular Formula | C12H12N2O5S2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 4-methyl-3-[2-(4-nitrophenyl)sulfonylethyl]-1,3-thiazol-2-one |
| SMILES | Cc1csc(=O)n1CCS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H12N2O5S2/c1-9-8-20-12(15)13(9)6-7-21(18,19)11-4-2-10(3-5-11)14(16)17/h2-5,8H,6-7H2,1H3 |
| InChIKey | OYWJOGVWLKQBKP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 99.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|