C17H25FN2O2S — CID 75454718
1-[cyclopentyl-(3-fluorophenyl)methyl]-3-(1-methylsulfinylpropan-2-yl)urea (PubChem CID 75454718) has the molecular formula C17H25FN2O2S and a molecular weight of 340.46 g/mol. Its IUPAC name is 1-[cyclopentyl-(3-fluorophenyl)methyl]-3-(1-methylsulfinylpropan-2-yl)urea.
| Compound Name | 1-[cyclopentyl-(3-fluorophenyl)methyl]-3-(1-methylsulfinylpropan-2-yl)urea |
|---|---|
| PubChem CID | 75454718 |
| Molecular Formula | C17H25FN2O2S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[cyclopentyl-(3-fluorophenyl)methyl]-3-(1-methylsulfinylpropan-2-yl)urea |
| SMILES | CC(CS(C)=O)NC(=O)NC(c1cccc(F)c1)C1CCCC1 |
| InChI | InChI=1S/C17H25FN2O2S/c1-12(11-23(2)22)19-17(21)20-16(13-6-3-4-7-13)14-8-5-9-15(18)10-14/h5,8-10,12-13,16H,3-4,6-7,11H2,1-2H3,(H2,19,20,21) |
| InChIKey | CFXZFLGOIRFDHD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |