C18H29N3O4 — CID 75455965
2-[[2-[N-(2,2-dimethoxyethyl)anilino]acetyl]-methylamino]-N-propylacetamide (PubChem CID 75455965) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[[2-[N-(2,2-dimethoxyethyl)anilino]acetyl]-methylamino]-N-propylacetamide.
| Compound Name | 2-[[2-[N-(2,2-dimethoxyethyl)anilino]acetyl]-methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 75455965 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-[[2-[N-(2,2-dimethoxyethyl)anilino]acetyl]-methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)C(=O)CN(CC(OC)OC)c1ccccc1 |
| InChI | InChI=1S/C18H29N3O4/c1-5-11-19-16(22)12-20(2)17(23)13-21(14-18(24-3)25-4)15-9-7-6-8-10-15/h6-10,18H,5,11-14H2,1-4H3,(H,19,22) |
| InChIKey | RUVCCFRAZYJWHX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|