C18H19N5O2 — CID 75456153
1-[6-(3,4-dimethylphenoxy)-3-pyridinyl]-3-(1-methylpyrazol-3-yl)urea (PubChem CID 75456153) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1-[6-(3,4-dimethylphenoxy)-3-pyridinyl]-3-(1-methylpyrazol-3-yl)urea.
| Compound Name | 1-[6-(3,4-dimethylphenoxy)-3-pyridinyl]-3-(1-methylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 75456153 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-[6-(3,4-dimethylphenoxy)-3-pyridinyl]-3-(1-methylpyrazol-3-yl)urea |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)Nc3ccn(C)n3)cn2)cc1C |
| InChI | InChI=1S/C18H19N5O2/c1-12-4-6-15(10-13(12)2)25-17-7-5-14(11-19-17)20-18(24)21-16-8-9-23(3)22-16/h4-11H,1-3H3,(H2,20,21,22,24) |
| InChIKey | FZDYDQFBNZTJLT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |