C25H24N4O4 — CID 55750359
N-[6-(3,4-dimethylphenoxy)-3-pyridinyl]-2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 55750359) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[6-(3,4-dimethylphenoxy)-3-pyridinyl]-2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | N-[6-(3,4-dimethylphenoxy)-3-pyridinyl]-2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 55750359 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[6-(3,4-dimethylphenoxy)-3-pyridinyl]-2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)CN3C(=O)NC(C)(c4ccccc4)C3=O)cn2)cc1C |
| InChI | InChI=1S/C25H24N4O4/c1-16-9-11-20(13-17(16)2)33-22-12-10-19(14-26-22)27-21(30)15-29-23(31)25(3,28-24(29)32)18-7-5-4-6-8-18/h4-14H,15H2,1-3H3,(H,27,30)(H,28,32) |
| InChIKey | QQZCZMKPYGSMGI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|