C19H27NO4 — CID 75456297
1-(3-acetamidophenyl)ethyl 8-oxononanoate (PubChem CID 75456297) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-(3-acetamidophenyl)ethyl 8-oxononanoate.
| Compound Name | 1-(3-acetamidophenyl)ethyl 8-oxononanoate |
|---|---|
| PubChem CID | 75456297 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-(3-acetamidophenyl)ethyl 8-oxononanoate |
| SMILES | CC(=O)CCCCCCC(=O)OC(C)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C19H27NO4/c1-14(21)9-6-4-5-7-12-19(23)24-15(2)17-10-8-11-18(13-17)20-16(3)22/h8,10-11,13,15H,4-7,9,12H2,1-3H3,(H,20,22) |
| InChIKey | BBBNBDBORACNPZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|