C25H28N2O7 — CID 139741048
bis[1-[3-(prop-2-enoxycarbonylamino)phenyl]ethyl] carbonate (PubChem CID 139741048) has the molecular formula C25H28N2O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is bis[1-[3-(prop-2-enoxycarbonylamino)phenyl]ethyl] carbonate.
| Compound Name | bis[1-[3-(prop-2-enoxycarbonylamino)phenyl]ethyl] carbonate |
|---|---|
| PubChem CID | 139741048 |
| Molecular Formula | C25H28N2O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | bis[1-[3-(prop-2-enoxycarbonylamino)phenyl]ethyl] carbonate |
| SMILES | C=CCOC(=O)Nc1cccc(C(C)OC(=O)OC(C)c2cccc(NC(=O)OCC=C)c2)c1 |
| InChI | InChI=1S/C25H28N2O7/c1-5-13-31-23(28)26-21-11-7-9-19(15-21)17(3)33-25(30)34-18(4)20-10-8-12-22(16-20)27-24(29)32-14-6-2/h5-12,15-18H,1-2,13-14H2,3-4H3,(H,26,28)(H,27,29) |
| InChIKey | GHUSHOLUQSCIQD-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|