C19H16F2N2O2 — CID 75456773
N-[3-(2,4-difluorophenyl)-2-hydroxypropyl]isoquinoline-1-carboxamide (PubChem CID 75456773) has the molecular formula C19H16F2N2O2 and a molecular weight of 342.35 g/mol. Its IUPAC name is N-[3-(2,4-difluorophenyl)-2-hydroxypropyl]isoquinoline-1-carboxamide.
| Compound Name | N-[3-(2,4-difluorophenyl)-2-hydroxypropyl]isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 75456773 |
| Molecular Formula | C19H16F2N2O2 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[3-(2,4-difluorophenyl)-2-hydroxypropyl]isoquinoline-1-carboxamide |
| SMILES | O=C(NCC(O)Cc1ccc(F)cc1F)c1nccc2ccccc12 |
| InChI | InChI=1S/C19H16F2N2O2/c20-14-6-5-13(17(21)10-14)9-15(24)11-23-19(25)18-16-4-2-1-3-12(16)7-8-22-18/h1-8,10,15,24H,9,11H2,(H,23,25) |
| InChIKey | VCTPYXBLHFXRDG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |