C16H19N5O — CID 75457244
2-methyl-2-[2-[(3-oxo-2,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]phenyl]propanenitrile (PubChem CID 75457244) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-methyl-2-[2-[(3-oxo-2,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]phenyl]propanenitrile.
| Compound Name | 2-methyl-2-[2-[(3-oxo-2,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]phenyl]propanenitrile |
|---|---|
| PubChem CID | 75457244 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-methyl-2-[2-[(3-oxo-2,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]phenyl]propanenitrile |
| SMILES | CC(C)(C#N)c1ccccc1CN1CCn2c(n[nH]c2=O)C1 |
| InChI | InChI=1S/C16H19N5O/c1-16(2,11-17)13-6-4-3-5-12(13)9-20-7-8-21-14(10-20)18-19-15(21)22/h3-6H,7-10H2,1-2H3,(H,19,22) |
| InChIKey | JCUVWLYSOIIVQB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |