C22H24N2O6 — CID 7546244
[2-(2-ethoxyanilino)-2-oxoethyl] (3S)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7546244) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] (3S)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] (3S)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7546244 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] (3S)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)[C@H]1CC(=O)N(c2ccccc2OC)C1 |
| InChI | InChI=1S/C22H24N2O6/c1-3-29-18-10-6-4-8-16(18)23-20(25)14-30-22(27)15-12-21(26)24(13-15)17-9-5-7-11-19(17)28-2/h4-11,15H,3,12-14H2,1-2H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | FMMYTXPYDRRLSD-HNNXBMFYSA-N |
| XLogP | 2.63 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |