C13H17BrN2O2 — CID 75462938
(E)-3-(5-bromofuran-2-yl)-1-(2,4-dimethylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 75462938) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is (E)-3-(5-bromofuran-2-yl)-1-(2,4-dimethylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromofuran-2-yl)-1-(2,4-dimethylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75462938 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (E)-3-(5-bromofuran-2-yl)-1-(2,4-dimethylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | CC1CN(C)CCN1C(=O)/C=C/c1ccc(Br)o1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-10-9-15(2)7-8-16(10)13(17)6-4-11-3-5-12(14)18-11/h3-6,10H,7-9H2,1-2H3/b6-4+ |
| InChIKey | ZRLNNPMCWPVLFF-GQCTYLIASA-N |
| XLogP | 2.22 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|