C20H22N2O4 — CID 5371033
(E)-3-(furan-2-yl)-1-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 5371033) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-1-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(furan-2-yl)-1-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 5371033 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (E)-3-(furan-2-yl)-1-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | CC1CN(C(=O)/C=C/c2ccco2)C(C)CN1C(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C20H22N2O4/c1-15-13-22(20(24)10-8-18-6-4-12-26-18)16(2)14-21(15)19(23)9-7-17-5-3-11-25-17/h3-12,15-16H,13-14H2,1-2H3/b9-7+,10-8+ |
| InChIKey | WCOOAGYNHBLAAJ-FIFLTTCUSA-N |
| XLogP | 3.05 |
| TPSA | 66.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|