C18H24N4O5 — CID 75464077
N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-[(5-methylfuran-2-carbonyl)amino]piperidine-1-carboxamide (PubChem CID 75464077) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-[(5-methylfuran-2-carbonyl)amino]piperidine-1-carboxamide.
| Compound Name | N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-[(5-methylfuran-2-carbonyl)amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 75464077 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-4-[(5-methylfuran-2-carbonyl)amino]piperidine-1-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(C(=O)NCCN3C(=O)CCC3=O)CC2)o1 |
| InChI | InChI=1S/C18H24N4O5/c1-12-2-3-14(27-12)17(25)20-13-6-9-21(10-7-13)18(26)19-8-11-22-15(23)4-5-16(22)24/h2-3,13H,4-11H2,1H3,(H,19,26)(H,20,25) |
| InChIKey | TTWZACQNLPCDCY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|