C19H20N6O2S — CID 75466011
2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]acetamide (PubChem CID 75466011) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is 2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]acetamide.
| Compound Name | 2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]acetamide |
|---|---|
| PubChem CID | 75466011 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]acetamide |
| SMILES | O=C(Cn1cnc2ccsc2c1=O)NCCCCCc1nnc2ccccn12 |
| InChI | InChI=1S/C19H20N6O2S/c26-17(12-24-13-21-14-8-11-28-18(14)19(24)27)20-9-4-1-2-6-15-22-23-16-7-3-5-10-25(15)16/h3,5,7-8,10-11,13H,1-2,4,6,9,12H2,(H,20,26) |
| InChIKey | AYFNIOWOTSTPGN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|