C18H19N3O3S — CID 24630190
2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-(3-phenylmethoxypropyl)acetamide (PubChem CID 24630190) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-(3-phenylmethoxypropyl)acetamide.
| Compound Name | 2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-(3-phenylmethoxypropyl)acetamide |
|---|---|
| PubChem CID | 24630190 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-(3-phenylmethoxypropyl)acetamide |
| SMILES | O=C(Cn1cnc2ccsc2c1=O)NCCCOCc1ccccc1 |
| InChI | InChI=1S/C18H19N3O3S/c22-16(11-21-13-20-15-7-10-25-17(15)18(21)23)19-8-4-9-24-12-14-5-2-1-3-6-14/h1-3,5-7,10,13H,4,8-9,11-12H2,(H,19,22) |
| InChIKey | OJGHHAALKMZLJW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|