C12H13ClN2O3S — CID 75466146
[1-(4-chlorophenyl)-2-pyrazol-1-ylethyl] methanesulfonate (PubChem CID 75466146) has the molecular formula C12H13ClN2O3S and a molecular weight of 300.77 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2-pyrazol-1-ylethyl] methanesulfonate.
| Compound Name | [1-(4-chlorophenyl)-2-pyrazol-1-ylethyl] methanesulfonate |
|---|---|
| PubChem CID | 75466146 |
| Molecular Formula | C12H13ClN2O3S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | [1-(4-chlorophenyl)-2-pyrazol-1-ylethyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC(Cn1cccn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN2O3S/c1-19(16,17)18-12(9-15-8-2-7-14-15)10-3-5-11(13)6-4-10/h2-8,12H,9H2,1H3 |
| InChIKey | WKPYGPBICNVMHU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|