C16H17Cl2NO3 — CID 75466524
methyl 1-(2,2-dichloro-1-methylcyclopropanecarbonyl)-3,4-dihydro-2H-quinoline-5-carboxylate (PubChem CID 75466524) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is methyl 1-(2,2-dichloro-1-methylcyclopropanecarbonyl)-3,4-dihydro-2H-quinoline-5-carboxylate.
| Compound Name | methyl 1-(2,2-dichloro-1-methylcyclopropanecarbonyl)-3,4-dihydro-2H-quinoline-5-carboxylate |
|---|---|
| PubChem CID | 75466524 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | methyl 1-(2,2-dichloro-1-methylcyclopropanecarbonyl)-3,4-dihydro-2H-quinoline-5-carboxylate |
| SMILES | COC(=O)c1cccc2c1CCCN2C(=O)C1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C16H17Cl2NO3/c1-15(9-16(15,17)18)14(21)19-8-4-6-10-11(13(20)22-2)5-3-7-12(10)19/h3,5,7H,4,6,8-9H2,1-2H3 |
| InChIKey | DPCOWPKVWSQXHU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|