About 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate
1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate (PubChem CID 165439271) has the molecular formula C16H20ClNO4
and a molecular weight of 325.79 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate |
| PubChem CID | 165439271 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2c(C(=O)OCCl)cccc21 |
| InChI | InChI=1S/C16H20ClNO4/c1-16(2,3)22-15(20)18-9-5-7-11-12(14(19)21-10-17)6-4-8-13(11)18/h4,6,8H,5,7,9-10H2,1-3H3 |
| InChIKey | YULKAOWQLDTOHM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate (CID 165439271) is 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate is CC(C)(C)OC(=O)N1CCCc2c(C(=O)OCCl)cccc21.
What is the InChIKey of 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate?
The InChIKey is YULKAOWQLDTOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClNO4/c1-16(2,3)22-15(20)18-9-5-7-11-12(14(19)21-10-17)6-4-8-13(11)18/h4,6,8H,5,7,9-10H2,1-3H3.
What are the key properties of 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate?
1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate has a molecular weight of 325.79 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-(chloromethyl) 3,4-dihydro-2H-quinoline-1,5-dicarboxylate is sourced from PubChem (CID 165439271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).