C15H20ClN3O2 — CID 169369551
tert-butyl 4-[(1-amino-2-chloroethylidene)amino]-2,3-dihydroindole-1-carboxylate (PubChem CID 169369551) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is tert-butyl 4-[(1-amino-2-chloroethylidene)amino]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 4-[(1-amino-2-chloroethylidene)amino]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 169369551 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | tert-butyl 4-[(1-amino-2-chloroethylidene)amino]-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(/N=C(/N)CCl)cccc21 |
| InChI | InChI=1S/C15H20ClN3O2/c1-15(2,3)21-14(20)19-8-7-10-11(18-13(17)9-16)5-4-6-12(10)19/h4-6H,7-9H2,1-3H3,(H2,17,18) |
| InChIKey | KAALSAYYBBQGDQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|