C20H20ClN3O2S — CID 170725401
tert-butyl 5-(6-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 170725401) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is tert-butyl 5-(6-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 5-(6-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 170725401 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | tert-butyl 5-(6-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2c(-c3nc4cc(Cl)ncc4s3)cccc21 |
| InChI | InChI=1S/C20H20ClN3O2S/c1-20(2,3)26-19(25)24-9-5-7-12-13(6-4-8-15(12)24)18-23-14-10-17(21)22-11-16(14)27-18/h4,6,8,10-11H,5,7,9H2,1-3H3 |
| InChIKey | BHYFQJCDBJOCTH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|