C16H14N2O2S2 — CID 75467297
5-acetyl-N-[2-(2-cyanoethylsulfanyl)phenyl]thiophene-2-carboxamide (PubChem CID 75467297) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-acetyl-N-[2-(2-cyanoethylsulfanyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-[2-(2-cyanoethylsulfanyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 75467297 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 5-acetyl-N-[2-(2-cyanoethylsulfanyl)phenyl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)Nc2ccccc2SCCC#N)s1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-11(19)13-7-8-15(22-13)16(20)18-12-5-2-3-6-14(12)21-10-4-9-17/h2-3,5-8H,4,10H2,1H3,(H,18,20) |
| InChIKey | NDIKFEVJHRVNNG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|