C17H16N2O3S2 — CID 75467241
N-[2-(2-cyanoethylsulfanyl)phenyl]-4-methylsulfonylbenzamide (PubChem CID 75467241) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[2-(2-cyanoethylsulfanyl)phenyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[2-(2-cyanoethylsulfanyl)phenyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 75467241 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-[2-(2-cyanoethylsulfanyl)phenyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccccc2SCCC#N)cc1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-24(21,22)14-9-7-13(8-10-14)17(20)19-15-5-2-3-6-16(15)23-12-4-11-18/h2-3,5-10H,4,12H2,1H3,(H,19,20) |
| InChIKey | XUXIUFMAEZMUJB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|