C17H16F3NO3S — CID 167869776
4-methylsulfonyl-N-[2-(3,3,3-trifluoropropyl)phenyl]benzamide (PubChem CID 167869776) has the molecular formula C17H16F3NO3S and a molecular weight of 371.38 g/mol. Its IUPAC name is 4-methylsulfonyl-N-[2-(3,3,3-trifluoropropyl)phenyl]benzamide.
| Compound Name | 4-methylsulfonyl-N-[2-(3,3,3-trifluoropropyl)phenyl]benzamide |
|---|---|
| PubChem CID | 167869776 |
| Molecular Formula | C17H16F3NO3S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 4-methylsulfonyl-N-[2-(3,3,3-trifluoropropyl)phenyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccccc2CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3NO3S/c1-25(23,24)14-8-6-13(7-9-14)16(22)21-15-5-3-2-4-12(15)10-11-17(18,19)20/h2-9H,10-11H2,1H3,(H,21,22) |
| InChIKey | MFSYCPOFKZVWTO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |