C18H24N4O2S — CID 75467392
1-[2-[2-(1-cyanopropan-2-ylsulfanyl)anilino]-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 75467392) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-[2-[2-(1-cyanopropan-2-ylsulfanyl)anilino]-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[2-(1-cyanopropan-2-ylsulfanyl)anilino]-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 75467392 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[2-[2-(1-cyanopropan-2-ylsulfanyl)anilino]-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | CC(CC#N)Sc1ccccc1NC(=O)CN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C18H24N4O2S/c1-13(6-9-19)25-16-5-3-2-4-15(16)21-17(23)12-22-10-7-14(8-11-22)18(20)24/h2-5,13-14H,6-8,10-12H2,1H3,(H2,20,24)(H,21,23) |
| InChIKey | ZVGCWMXPMHKVJX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |